C12H22N2O6 — CID 21316317
1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-6,17-dione (PubChem CID 21316317) has the molecular formula C12H22N2O6 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-6,17-dione.
| Compound Name | 1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-6,17-dione |
|---|---|
| PubChem CID | 21316317 |
| Molecular Formula | C12H22N2O6 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-6,17-dione |
| SMILES | O=C1COCCOCC(=O)NCCOCCOCCN1 |
| InChI | InChI=1S/C12H22N2O6/c15-11-9-19-7-8-20-10-12(16)14-2-4-18-6-5-17-3-1-13-11/h1-10H2,(H,13,15)(H,14,16) |
| InChIKey | LPRXZJHJSRYFFR-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |