About 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile
2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile (PubChem CID 21316402) has the molecular formula C8H14N2S
and a molecular weight of 170.28 g/mol. Its IUPAC name is 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile |
| PubChem CID | 21316402 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile |
| SMILES | CC(C)C1(C)NC(C#N)CS1 |
| InChI | InChI=1S/C8H14N2S/c1-6(2)8(3)10-7(4-9)5-11-8/h6-7,10H,5H2,1-3H3 |
| InChIKey | APFFFPDHHWNKIM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile?
The IUPAC name of 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile (CID 21316402) is 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile.
What is the SMILES notation for 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile?
The canonical SMILES for 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile is CC(C)C1(C)NC(C#N)CS1.
What is the InChIKey of 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile?
The InChIKey is APFFFPDHHWNKIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2S/c1-6(2)8(3)10-7(4-9)5-11-8/h6-7,10H,5H2,1-3H3.
What are the key properties of 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile?
2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile has a molecular weight of 170.28 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-propan-2-yl-1,3-thiazolidine-4-carbonitrile is sourced from PubChem (CID 21316402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).