About 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile
2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile (PubChem CID 21316424) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile |
| PubChem CID | 21316424 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile |
| SMILES | C/C=C/CC1NC(C#N)CS1 |
| InChI | InChI=1S/C8H12N2S/c1-2-3-4-8-10-7(5-9)6-11-8/h2-3,7-8,10H,4,6H2,1H3/b3-2+ |
| InChIKey | IYXBYJJJJIQQFO-NSCUHMNNSA-N |
| XLogP | 1.51 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile?
The IUPAC name of 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile (CID 21316424) is 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile.
What is the SMILES notation for 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile?
The canonical SMILES for 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile is C/C=C/CC1NC(C#N)CS1.
What is the InChIKey of 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile?
The InChIKey is IYXBYJJJJIQQFO-NSCUHMNNSA-N. The full InChI is InChI=1S/C8H12N2S/c1-2-3-4-8-10-7(5-9)6-11-8/h2-3,7-8,10H,4,6H2,1H3/b3-2+.
What are the key properties of 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile?
2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile has a molecular weight of 168.26 g/mol, XLogP of 1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-but-2-enyl]-1,3-thiazolidine-4-carbonitrile is sourced from PubChem (CID 21316424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).