About 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide
2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide (PubChem CID 21316638) has the molecular formula C17H15ClN2O3S
and a molecular weight of 362.84 g/mol. Its IUPAC name is 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide |
| PubChem CID | 21316638 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide |
| SMILES | Cc1c(C(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)c2ccccc2n1C |
| InChI | InChI=1S/C17H15ClN2O3S/c1-10-16(12-5-3-4-6-14(12)20(10)2)17(21)11-7-8-13(18)15(9-11)24(19,22)23/h3-9H,1-2H3,(H2,19,22,23) |
| InChIKey | WNPHSKYOYVSMHU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide?
The IUPAC name of 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide (CID 21316638) is 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide.
What is the SMILES notation for 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide?
The canonical SMILES for 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide is Cc1c(C(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)c2ccccc2n1C.
What is the InChIKey of 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide?
The InChIKey is WNPHSKYOYVSMHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN2O3S/c1-10-16(12-5-3-4-6-14(12)20(10)2)17(21)11-7-8-13(18)15(9-11)24(19,22)23/h3-9H,1-2H3,(H2,19,22,23).
What are the key properties of 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide?
2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide has a molecular weight of 362.84 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(1,2-dimethylindole-3-carbonyl)benzenesulfonamide is sourced from PubChem (CID 21316638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).