C17H14Cl2N2O3S2 — CID 2131674
4-[[4-(2,4-dichlorophenyl)-3-ethyl-1,3-thiazol-2-ylidene]amino]benzenesulfonic acid (PubChem CID 2131674) has the molecular formula C17H14Cl2N2O3S2 and a molecular weight of 429.35 g/mol. Its IUPAC name is 4-[[4-(2,4-dichlorophenyl)-3-ethyl-1,3-thiazol-2-ylidene]amino]benzenesulfonic acid.
| Compound Name | 4-[[4-(2,4-dichlorophenyl)-3-ethyl-1,3-thiazol-2-ylidene]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 2131674 |
| Molecular Formula | C17H14Cl2N2O3S2 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | 4-[[4-(2,4-dichlorophenyl)-3-ethyl-1,3-thiazol-2-ylidene]amino]benzenesulfonic acid |
| SMILES | CCn1c(-c2ccc(Cl)cc2Cl)cs/c1=N\c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H14Cl2N2O3S2/c1-2-21-16(14-8-3-11(18)9-15(14)19)10-25-17(21)20-12-4-6-13(7-5-12)26(22,23)24/h3-10H,2H2,1H3,(H,22,23,24)/b20-17- |
| InChIKey | DKINSCKCIBUEJU-JZJYNLBNSA-N |
| XLogP | 5.02 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|