C13H17ClN4O2 — CID 21316963
4-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl)-2-nitroaniline;hydrochloride (PubChem CID 21316963) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is 4-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl)-2-nitroaniline;hydrochloride.
| Compound Name | 4-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl)-2-nitroaniline;hydrochloride |
|---|---|
| PubChem CID | 21316963 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl)-2-nitroaniline;hydrochloride |
| SMILES | Cl.Nc1ccc(C2=NC3CCCCC3N2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N4O2.ClH/c14-9-6-5-8(7-12(9)17(18)19)13-15-10-3-1-2-4-11(10)16-13;/h5-7,10-11H,1-4,14H2,(H,15,16);1H |
| InChIKey | KDAQINAKFWEKKR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|