About thiophene-2,5-dicarboxamide
thiophene-2,5-dicarboxamide (PubChem CID 21316969) has the molecular formula C6H6N2O2S
and a molecular weight of 170.19 g/mol. Its IUPAC name is thiophene-2,5-dicarboxamide.
Molecular Properties
| Compound Name | thiophene-2,5-dicarboxamide |
| PubChem CID | 21316969 |
| Molecular Formula | C6H6N2O2S |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | thiophene-2,5-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)s1 |
| InChI | InChI=1S/C6H6N2O2S/c7-5(9)3-1-2-4(11-3)6(8)10/h1-2H,(H2,7,9)(H2,8,10) |
| InChIKey | OSCGNYRBEMVTNP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thiophene-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene-2,5-dicarboxamide?
The IUPAC name of thiophene-2,5-dicarboxamide (CID 21316969) is thiophene-2,5-dicarboxamide.
What is the SMILES notation for thiophene-2,5-dicarboxamide?
The canonical SMILES for thiophene-2,5-dicarboxamide is NC(=O)c1ccc(C(N)=O)s1.
What is the InChIKey of thiophene-2,5-dicarboxamide?
The InChIKey is OSCGNYRBEMVTNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2S/c7-5(9)3-1-2-4(11-3)6(8)10/h1-2H,(H2,7,9)(H2,8,10).
What are the key properties of thiophene-2,5-dicarboxamide?
thiophene-2,5-dicarboxamide has a molecular weight of 170.19 g/mol, XLogP of -0.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene-2,5-dicarboxamide is sourced from PubChem (CID 21316969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).