About 2-ethoxyethyl but-3-enoate
2-ethoxyethyl but-3-enoate (PubChem CID 21316987) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-ethoxyethyl but-3-enoate.
Molecular Properties
| Compound Name | 2-ethoxyethyl but-3-enoate |
| PubChem CID | 21316987 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2-ethoxyethyl but-3-enoate |
| SMILES | C=CCC(=O)OCCOCC |
| InChI | InChI=1S/C8H14O3/c1-3-5-8(9)11-7-6-10-4-2/h3H,1,4-7H2,2H3 |
| InChIKey | LVOOTISVVRLBSX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl but-3-enoate?
The IUPAC name of 2-ethoxyethyl but-3-enoate (CID 21316987) is 2-ethoxyethyl but-3-enoate.
What is the SMILES notation for 2-ethoxyethyl but-3-enoate?
The canonical SMILES for 2-ethoxyethyl but-3-enoate is C=CCC(=O)OCCOCC.
What is the InChIKey of 2-ethoxyethyl but-3-enoate?
The InChIKey is LVOOTISVVRLBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-3-5-8(9)11-7-6-10-4-2/h3H,1,4-7H2,2H3.
What are the key properties of 2-ethoxyethyl but-3-enoate?
2-ethoxyethyl but-3-enoate has a molecular weight of 158.20 g/mol, XLogP of 1.14, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl but-3-enoate is sourced from PubChem (CID 21316987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).