C22H37F3O6 — CID 21317557
6-acetyloxy-2-(7-ethoxy-7-oxoheptyl)-11,11,11-trifluoroundecanoic acid (PubChem CID 21317557) has the molecular formula C22H37F3O6 and a molecular weight of 454.53 g/mol. Its IUPAC name is 6-acetyloxy-2-(7-ethoxy-7-oxoheptyl)-11,11,11-trifluoroundecanoic acid.
| Compound Name | 6-acetyloxy-2-(7-ethoxy-7-oxoheptyl)-11,11,11-trifluoroundecanoic acid |
|---|---|
| PubChem CID | 21317557 |
| Molecular Formula | C22H37F3O6 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 6-acetyloxy-2-(7-ethoxy-7-oxoheptyl)-11,11,11-trifluoroundecanoic acid |
| SMILES | CCOC(=O)CCCCCCC(CCCC(CCCCC(F)(F)F)OC(C)=O)C(=O)O |
| InChI | InChI=1S/C22H37F3O6/c1-3-30-20(27)15-7-5-4-6-11-18(21(28)29)12-10-14-19(31-17(2)26)13-8-9-16-22(23,24)25/h18-19H,3-16H2,1-2H3,(H,28,29) |
| InChIKey | UUOLMOANFHVKFP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|