About 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide
5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide (PubChem CID 21318193) has the molecular formula C17H15N3O3
and a molecular weight of 309.32 g/mol. Its IUPAC name is 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide.
Molecular Properties
| Compound Name | 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide |
| PubChem CID | 21318193 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide |
| SMILES | C=C1NC(=O)N(c2ccccc2)C1=O.O=CNc1ccccc1 |
| InChI | InChI=1S/C10H8N2O2.C7H7NO/c1-7-9(13)12(10(14)11-7)8-5-3-2-4-6-8;9-6-8-7-4-2-1-3-5-7/h2-6H,1H2,(H,11,14);1-6H,(H,8,9) |
| InChIKey | YHZJIWLICXAWFH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide?
The IUPAC name of 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide (CID 21318193) is 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide.
What is the SMILES notation for 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide?
The canonical SMILES for 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide is C=C1NC(=O)N(c2ccccc2)C1=O.O=CNc1ccccc1.
What is the InChIKey of 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide?
The InChIKey is YHZJIWLICXAWFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2.C7H7NO/c1-7-9(13)12(10(14)11-7)8-5-3-2-4-6-8;9-6-8-7-4-2-1-3-5-7/h2-6H,1H2,(H,11,14);1-6H,(H,8,9).
What are the key properties of 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide?
5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide has a molecular weight of 309.32 g/mol, XLogP of 2.51, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylidene-3-phenylimidazolidine-2,4-dione;N-phenylformamide is sourced from PubChem (CID 21318193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).