C24H24ClN3O3 — CID 2131824
N-[(Z)-1-[5-(4-chlorophenyl)furan-2-yl]-3-[2-(dimethylamino)ethylamino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 2131824) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is N-[(Z)-1-[5-(4-chlorophenyl)furan-2-yl]-3-[2-(dimethylamino)ethylamino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-[5-(4-chlorophenyl)furan-2-yl]-3-[2-(dimethylamino)ethylamino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 2131824 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[(Z)-1-[5-(4-chlorophenyl)furan-2-yl]-3-[2-(dimethylamino)ethylamino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CN(C)CCNC(=O)/C(=C/c1ccc(-c2ccc(Cl)cc2)o1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24ClN3O3/c1-28(2)15-14-26-24(30)21(27-23(29)18-6-4-3-5-7-18)16-20-12-13-22(31-20)17-8-10-19(25)11-9-17/h3-13,16H,14-15H2,1-2H3,(H,26,30)(H,27,29)/b21-16- |
| InChIKey | WDIVNGNSTQACEP-PGMHBOJBSA-N |
| XLogP | 4.05 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|