C10H14N4O5S2 — CID 21318263
3-(5-butylsulfonyl-1,3,4-thiadiazol-2-yl)-5-hydroxy-1-methylimidazolidine-2,4-dione (PubChem CID 21318263) has the molecular formula C10H14N4O5S2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-(5-butylsulfonyl-1,3,4-thiadiazol-2-yl)-5-hydroxy-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-(5-butylsulfonyl-1,3,4-thiadiazol-2-yl)-5-hydroxy-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 21318263 |
| Molecular Formula | C10H14N4O5S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 3-(5-butylsulfonyl-1,3,4-thiadiazol-2-yl)-5-hydroxy-1-methylimidazolidine-2,4-dione |
| SMILES | CCCCS(=O)(=O)c1nnc(N2C(=O)C(O)N(C)C2=O)s1 |
| InChI | InChI=1S/C10H14N4O5S2/c1-3-4-5-21(18,19)9-12-11-8(20-9)14-7(16)6(15)13(2)10(14)17/h6,15H,3-5H2,1-2H3 |
| InChIKey | LYUFHTMNQBNCAF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|