About 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene
1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 21319053) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene.
Molecular Properties
| Compound Name | 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
| PubChem CID | 21319053 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | COCC(O)CN.c1ccc2c(c1)O2 |
| InChI | InChI=1S/C6H4O.C4H11NO2/c1-2-4-6-5(3-1)7-6;1-7-3-4(6)2-5/h1-4H;4,6H,2-3,5H2,1H3 |
| InChIKey | YVGFPYDHGVFWTI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene?
The IUPAC name of 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene (CID 21319053) is 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene.
What is the SMILES notation for 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene?
The canonical SMILES for 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene is COCC(O)CN.c1ccc2c(c1)O2.
What is the InChIKey of 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene?
The InChIKey is YVGFPYDHGVFWTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O.C4H11NO2/c1-2-4-6-5(3-1)7-6;1-7-3-4(6)2-5/h1-4H;4,6H,2-3,5H2,1H3.
What are the key properties of 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene?
1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene has a molecular weight of 197.23 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-methoxypropan-2-ol;7-oxabicyclo[4.1.0]hepta-1,3,5-triene is sourced from PubChem (CID 21319053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).