About [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate
[1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate (PubChem CID 21319185) has the molecular formula C20H19BrCl2O4
and a molecular weight of 474.18 g/mol. Its IUPAC name is [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate.
Molecular Properties
| Compound Name | [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate |
| PubChem CID | 21319185 |
| Molecular Formula | C20H19BrCl2O4 |
| Molecular Weight | 474.18 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate |
| SMILES | CC(=O)OC(Br)(Oc1ccc(Cl)cc1Cl)C(=O)C(C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C20H19BrCl2O4/c1-13(24)26-20(21,27-17-10-9-15(22)11-16(17)23)18(25)19(2,3)12-14-7-5-4-6-8-14/h4-11H,12H2,1-3H3 |
| InChIKey | XOPZCEPEMOQBAQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.18 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate?
The IUPAC name of [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate (CID 21319185) is [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate.
What is the SMILES notation for [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate?
The canonical SMILES for [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate is CC(=O)OC(Br)(Oc1ccc(Cl)cc1Cl)C(=O)C(C)(C)Cc1ccccc1.
What is the InChIKey of [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate?
The InChIKey is XOPZCEPEMOQBAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19BrCl2O4/c1-13(24)26-20(21,27-17-10-9-15(22)11-16(17)23)18(25)19(2,3)12-14-7-5-4-6-8-14/h4-11H,12H2,1-3H3.
What are the key properties of [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate?
[1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate has a molecular weight of 474.18 g/mol, XLogP of 5.82, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-bromo-1-(2,4-dichlorophenoxy)-3,3-dimethyl-2-oxo-4-phenylbutyl] acetate is sourced from PubChem (CID 21319185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).