About 1H-benzo[7]annulene
1H-benzo[7]annulene (PubChem CID 21319341) has the molecular formula C11H10
and a molecular weight of 142.20 g/mol. Its IUPAC name is 1H-benzo[7]annulene.
Molecular Properties
| Compound Name | 1H-benzo[7]annulene |
| PubChem CID | 21319341 |
| Molecular Formula | C11H10 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 1H-benzo[7]annulene |
| SMILES | C1=CC=C2CC=CC=C2C=C1 |
| InChI | InChI=1S/C11H10/c1-2-6-10-8-4-5-9-11(10)7-3-1/h1-8H,9H2 |
| InChIKey | ZVCPCZRXWGOICC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1H-benzo[7]annulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzo[7]annulene?
The IUPAC name of 1H-benzo[7]annulene (CID 21319341) is 1H-benzo[7]annulene.
What is the SMILES notation for 1H-benzo[7]annulene?
The canonical SMILES for 1H-benzo[7]annulene is C1=CC=C2CC=CC=C2C=C1.
What is the InChIKey of 1H-benzo[7]annulene?
The InChIKey is ZVCPCZRXWGOICC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10/c1-2-6-10-8-4-5-9-11(10)7-3-1/h1-8H,9H2.
What are the key properties of 1H-benzo[7]annulene?
1H-benzo[7]annulene has a molecular weight of 142.20 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzo[7]annulene is sourced from PubChem (CID 21319341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).