About 1H-benzo[7]annulen-5-ol
1H-benzo[7]annulen-5-ol (PubChem CID 21319344) has the molecular formula C11H10O
and a molecular weight of 158.20 g/mol. Its IUPAC name is 1H-benzo[7]annulen-5-ol.
Molecular Properties
| Compound Name | 1H-benzo[7]annulen-5-ol |
| PubChem CID | 21319344 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 1H-benzo[7]annulen-5-ol |
| SMILES | OC1=CC=CC=C2CC=CC=C12 |
| InChI | InChI=1S/C11H10O/c12-11-8-4-2-6-9-5-1-3-7-10(9)11/h1-4,6-8,12H,5H2 |
| InChIKey | TUWSWSOREAUSCJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-benzo[7]annulen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzo[7]annulen-5-ol?
The IUPAC name of 1H-benzo[7]annulen-5-ol (CID 21319344) is 1H-benzo[7]annulen-5-ol.
What is the SMILES notation for 1H-benzo[7]annulen-5-ol?
The canonical SMILES for 1H-benzo[7]annulen-5-ol is OC1=CC=CC=C2CC=CC=C12.
What is the InChIKey of 1H-benzo[7]annulen-5-ol?
The InChIKey is TUWSWSOREAUSCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O/c12-11-8-4-2-6-9-5-1-3-7-10(9)11/h1-4,6-8,12H,5H2.
What are the key properties of 1H-benzo[7]annulen-5-ol?
1H-benzo[7]annulen-5-ol has a molecular weight of 158.20 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzo[7]annulen-5-ol is sourced from PubChem (CID 21319344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).