About 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid
5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid (PubChem CID 21319409) has the molecular formula C13H17F4NO4S
and a molecular weight of 359.34 g/mol. Its IUPAC name is 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid |
| PubChem CID | 21319409 |
| Molecular Formula | C13H17F4NO4S |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid |
| SMILES | CCC(=O)SCC(C(=O)N1CC(F)CCC1C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C13H17F4NO4S/c1-2-10(19)23-6-8(13(15,16)17)11(20)18-5-7(14)3-4-9(18)12(21)22/h7-9H,2-6H2,1H3,(H,21,22) |
| InChIKey | ATIDFLGFVICCQL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid?
The IUPAC name of 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid (CID 21319409) is 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid.
What is the SMILES notation for 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid?
The canonical SMILES for 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid is CCC(=O)SCC(C(=O)N1CC(F)CCC1C(=O)O)C(F)(F)F.
What is the InChIKey of 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid?
The InChIKey is ATIDFLGFVICCQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F4NO4S/c1-2-10(19)23-6-8(13(15,16)17)11(20)18-5-7(14)3-4-9(18)12(21)22/h7-9H,2-6H2,1H3,(H,21,22).
What are the key properties of 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid?
5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid has a molecular weight of 359.34 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-[3,3,3-trifluoro-2-(propanoylsulfanylmethyl)propanoyl]piperidine-2-carboxylic acid is sourced from PubChem (CID 21319409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).