About [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate
[1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate (PubChem CID 21320034) has the molecular formula C18H21F3N2O3
and a molecular weight of 370.37 g/mol. Its IUPAC name is [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate.
Molecular Properties
| Compound Name | [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate |
| PubChem CID | 21320034 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate |
| SMILES | CC(=O)OC(C(Oc1cccc(C(F)(F)F)c1)n1ccnc1)C(C)(C)C |
| InChI | InChI=1S/C18H21F3N2O3/c1-12(24)25-15(17(2,3)4)16(23-9-8-22-11-23)26-14-7-5-6-13(10-14)18(19,20)21/h5-11,15-16H,1-4H3 |
| InChIKey | UTIPYDXPBLTLMJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate?
The IUPAC name of [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate (CID 21320034) is [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate.
What is the SMILES notation for [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate?
The canonical SMILES for [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate is CC(=O)OC(C(Oc1cccc(C(F)(F)F)c1)n1ccnc1)C(C)(C)C.
What is the InChIKey of [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate?
The InChIKey is UTIPYDXPBLTLMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21F3N2O3/c1-12(24)25-15(17(2,3)4)16(23-9-8-22-11-23)26-14-7-5-6-13(10-14)18(19,20)21/h5-11,15-16H,1-4H3.
What are the key properties of [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate?
[1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate has a molecular weight of 370.37 g/mol, XLogP of 4.46, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-imidazol-1-yl-3,3-dimethyl-1-[3-(trifluoromethyl)phenoxy]butan-2-yl] acetate is sourced from PubChem (CID 21320034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).