C8H11BrClN3 — CID 21320083
7-chloro-2,5-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrobromide (PubChem CID 21320083) has the molecular formula C8H11BrClN3 and a molecular weight of 264.55 g/mol. Its IUPAC name is 7-chloro-2,5-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrobromide.
| Compound Name | 7-chloro-2,5-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrobromide |
|---|---|
| PubChem CID | 21320083 |
| Molecular Formula | C8H11BrClN3 |
| Molecular Weight | 264.55 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 7-chloro-2,5-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrobromide |
| SMILES | Br.CC1=NC(Cl)=CC2=NC(C)CN12 |
| InChI | InChI=1S/C8H10ClN3.BrH/c1-5-4-12-6(2)11-7(9)3-8(12)10-5;/h3,5H,4H2,1-2H3;1H |
| InChIKey | HEWXKNJBWHNYSV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|