About 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride
3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride (PubChem CID 21320092) has the molecular formula C8H12ClN3S
and a molecular weight of 217.72 g/mol. Its IUPAC name is 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride |
| PubChem CID | 21320092 |
| Molecular Formula | C8H12ClN3S |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride |
| SMILES | CSC1=NC=CC2=NCC(C)N21.Cl |
| InChI | InChI=1S/C8H11N3S.ClH/c1-6-5-10-7-3-4-9-8(12-2)11(6)7;/h3-4,6H,5H2,1-2H3;1H |
| InChIKey | GVIKVMVVDALGFM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride?
The IUPAC name of 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride (CID 21320092) is 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride.
What is the SMILES notation for 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride?
The canonical SMILES for 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride is CSC1=NC=CC2=NCC(C)N21.Cl.
What is the InChIKey of 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride?
The InChIKey is GVIKVMVVDALGFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S.ClH/c1-6-5-10-7-3-4-9-8(12-2)11(6)7;/h3-4,6H,5H2,1-2H3;1H.
What are the key properties of 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride?
3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride has a molecular weight of 217.72 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-methylsulfanyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride is sourced from PubChem (CID 21320092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).