C9H12ClN3 — CID 21320097
7-chloro-2,3,5-trimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine (PubChem CID 21320097) has the molecular formula C9H12ClN3 and a molecular weight of 197.67 g/mol. Its IUPAC name is 7-chloro-2,3,5-trimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine.
| Compound Name | 7-chloro-2,3,5-trimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 21320097 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 7-chloro-2,3,5-trimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine |
| SMILES | CC1=NC(Cl)=CC2=NC(C)C(C)N12 |
| InChI | InChI=1S/C9H12ClN3/c1-5-6(2)13-7(3)12-8(10)4-9(13)11-5/h4-6H,1-3H3 |
| InChIKey | KPVXAXHXXOSIHS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|