About 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride
7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride (PubChem CID 21320115) has the molecular formula C8H11Cl2N3
and a molecular weight of 220.10 g/mol. Its IUPAC name is 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride |
| PubChem CID | 21320115 |
| Molecular Formula | C8H11Cl2N3 |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride |
| SMILES | CCC1=NC(Cl)=CC2=NCCN21.Cl |
| InChI | InChI=1S/C8H10ClN3.ClH/c1-2-7-11-6(9)5-8-10-3-4-12(7)8;/h5H,2-4H2,1H3;1H |
| InChIKey | ODBRBWOACPKROW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride?
The IUPAC name of 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride (CID 21320115) is 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride.
What is the SMILES notation for 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride?
The canonical SMILES for 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride is CCC1=NC(Cl)=CC2=NCCN21.Cl.
What is the InChIKey of 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride?
The InChIKey is ODBRBWOACPKROW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN3.ClH/c1-2-7-11-6(9)5-8-10-3-4-12(7)8;/h5H,2-4H2,1H3;1H.
What are the key properties of 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride?
7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride has a molecular weight of 220.10 g/mol, XLogP of 2.02, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-ethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride is sourced from PubChem (CID 21320115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).