C8H11Cl2N3 — CID 21320120
7-chloro-3,5-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride (PubChem CID 21320120) has the molecular formula C8H11Cl2N3 and a molecular weight of 220.10 g/mol. Its IUPAC name is 7-chloro-3,5-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride.
| Compound Name | 7-chloro-3,5-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 21320120 |
| Molecular Formula | C8H11Cl2N3 |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 7-chloro-3,5-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine;hydrochloride |
| SMILES | CC1=NC(Cl)=CC2=NCC(C)N12.Cl |
| InChI | InChI=1S/C8H10ClN3.ClH/c1-5-4-10-8-3-7(9)11-6(2)12(5)8;/h3,5H,4H2,1-2H3;1H |
| InChIKey | CLBIUDYQTZSYQI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|