About 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane
2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane (PubChem CID 21320601) has the molecular formula C9H15N3O4
and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane.
Molecular Properties
| Compound Name | 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane |
| PubChem CID | 21320601 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane |
| SMILES | COc1ccc(N)c([N+](=O)[O-])c1CCO.N |
| InChI | InChI=1S/C9H12N2O4.H3N/c1-15-8-3-2-7(10)9(11(13)14)6(8)4-5-12;/h2-3,12H,4-5,10H2,1H3;1H3 |
| InChIKey | LNRDLFGLSYPUJQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane?
The IUPAC name of 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane (CID 21320601) is 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane.
What is the SMILES notation for 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane?
The canonical SMILES for 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane is COc1ccc(N)c([N+](=O)[O-])c1CCO.N.
What is the InChIKey of 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane?
The InChIKey is LNRDLFGLSYPUJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4.H3N/c1-15-8-3-2-7(10)9(11(13)14)6(8)4-5-12;/h2-3,12H,4-5,10H2,1H3;1H3.
What are the key properties of 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane?
2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane has a molecular weight of 229.24 g/mol, XLogP of 0.88, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-6-methoxy-2-nitrophenyl)ethanol;azane is sourced from PubChem (CID 21320601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).