About azanium 2-benzamidooxyacetate
azanium 2-benzamidooxyacetate (PubChem CID 21321) has the molecular formula C9H12N2O4
and a molecular weight of 212.20 g/mol. Its IUPAC name is azanium 2-benzamidooxyacetate.
Molecular Properties
| Compound Name | azanium 2-benzamidooxyacetate |
| PubChem CID | 21321 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | azanium 2-benzamidooxyacetate |
| SMILES | O=C([O-])CONC(=O)c1ccccc1.[NH4+] |
| InChI | InChI=1S/C9H9NO4.H3N/c11-8(12)6-14-10-9(13)7-4-2-1-3-5-7;/h1-5H,6H2,(H,10,13)(H,11,12);1H3 |
| InChIKey | ARRGVXFLPAQYKA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azanium 2-benzamidooxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 2-benzamidooxyacetate?
The IUPAC name of azanium 2-benzamidooxyacetate (CID 21321) is azanium 2-benzamidooxyacetate.
What is the SMILES notation for azanium 2-benzamidooxyacetate?
The canonical SMILES for azanium 2-benzamidooxyacetate is O=C([O-])CONC(=O)c1ccccc1.[NH4+].
What is the InChIKey of azanium 2-benzamidooxyacetate?
The InChIKey is ARRGVXFLPAQYKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4.H3N/c11-8(12)6-14-10-9(13)7-4-2-1-3-5-7;/h1-5H,6H2,(H,10,13)(H,11,12);1H3.
What are the key properties of azanium 2-benzamidooxyacetate?
azanium 2-benzamidooxyacetate has a molecular weight of 212.20 g/mol, XLogP of -0.53, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 2-benzamidooxyacetate is sourced from PubChem (CID 21321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).