C22H35NO2 — CID 21321041
N-[3,5-bis(2,3-dimethylbutan-2-yl)-4-hydroxyphenyl]-2-methylprop-2-enamide (PubChem CID 21321041) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is N-[3,5-bis(2,3-dimethylbutan-2-yl)-4-hydroxyphenyl]-2-methylprop-2-enamide.
| Compound Name | N-[3,5-bis(2,3-dimethylbutan-2-yl)-4-hydroxyphenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 21321041 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | N-[3,5-bis(2,3-dimethylbutan-2-yl)-4-hydroxyphenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1cc(C(C)(C)C(C)C)c(O)c(C(C)(C)C(C)C)c1 |
| InChI | InChI=1S/C22H35NO2/c1-13(2)20(25)23-16-11-17(21(7,8)14(3)4)19(24)18(12-16)22(9,10)15(5)6/h11-12,14-15,24H,1H2,2-10H3,(H,23,25) |
| InChIKey | FYELAQCTUCZEQL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|