C14H12F3N3O3S — CID 21321153
[[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-1,3-thiazol-2-yl]amino] acetate (PubChem CID 21321153) has the molecular formula C14H12F3N3O3S and a molecular weight of 359.33 g/mol. Its IUPAC name is [[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-1,3-thiazol-2-yl]amino] acetate.
| Compound Name | [[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-1,3-thiazol-2-yl]amino] acetate |
|---|---|
| PubChem CID | 21321153 |
| Molecular Formula | C14H12F3N3O3S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-1,3-thiazol-2-yl]amino] acetate |
| SMILES | CC(=O)ONc1nc(CC(=O)Nc2cccc(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C14H12F3N3O3S/c1-8(21)23-20-13-19-11(7-24-13)6-12(22)18-10-4-2-3-9(5-10)14(15,16)17/h2-5,7H,6H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | KBMNXEINEHTXLT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|