About (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol
(3-propan-2-yl-1,3-oxazolidin-5-yl)methanol (PubChem CID 21321287) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol.
Molecular Properties
| Compound Name | (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol |
| PubChem CID | 21321287 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol |
| SMILES | CC(C)N1COC(CO)C1 |
| InChI | InChI=1S/C7H15NO2/c1-6(2)8-3-7(4-9)10-5-8/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | HOQQLSSNWLRSSA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol?
The IUPAC name of (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol (CID 21321287) is (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol.
What is the SMILES notation for (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol?
The canonical SMILES for (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol is CC(C)N1COC(CO)C1.
What is the InChIKey of (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol?
The InChIKey is HOQQLSSNWLRSSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-6(2)8-3-7(4-9)10-5-8/h6-7,9H,3-5H2,1-2H3.
What are the key properties of (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol?
(3-propan-2-yl-1,3-oxazolidin-5-yl)methanol has a molecular weight of 145.20 g/mol, XLogP of 0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propan-2-yl-1,3-oxazolidin-5-yl)methanol is sourced from PubChem (CID 21321287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).