About 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline
4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline (PubChem CID 21321343) has the molecular formula C13H10Cl3N
and a molecular weight of 286.59 g/mol. Its IUPAC name is 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline.
Molecular Properties
| Compound Name | 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline |
| PubChem CID | 21321343 |
| Molecular Formula | C13H10Cl3N |
| Molecular Weight | 286.59 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline |
| SMILES | Clc1ccc(NCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C13H10Cl3N/c14-10-2-4-11(5-3-10)17-8-9-1-6-12(15)13(16)7-9/h1-7,17H,8H2 |
| InChIKey | VIZWDAOZENFBIZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline?
The IUPAC name of 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline (CID 21321343) is 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline.
What is the SMILES notation for 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline?
The canonical SMILES for 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline is Clc1ccc(NCc2ccc(Cl)c(Cl)c2)cc1.
What is the InChIKey of 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline?
The InChIKey is VIZWDAOZENFBIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl3N/c14-10-2-4-11(5-3-10)17-8-9-1-6-12(15)13(16)7-9/h1-7,17H,8H2.
What are the key properties of 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline?
4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline has a molecular weight of 286.59 g/mol, XLogP of 5.26, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(3,4-dichlorophenyl)methyl]aniline is sourced from PubChem (CID 21321343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).