C13H17Cl2N3O2S — CID 21321569
4-chloro-2-nitro-N-(2-pyrrolidin-1-ylethyl)benzenecarbothioamide;hydrochloride (PubChem CID 21321569) has the molecular formula C13H17Cl2N3O2S and a molecular weight of 350.27 g/mol. Its IUPAC name is 4-chloro-2-nitro-N-(2-pyrrolidin-1-ylethyl)benzenecarbothioamide;hydrochloride.
| Compound Name | 4-chloro-2-nitro-N-(2-pyrrolidin-1-ylethyl)benzenecarbothioamide;hydrochloride |
|---|---|
| PubChem CID | 21321569 |
| Molecular Formula | C13H17Cl2N3O2S |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 4-chloro-2-nitro-N-(2-pyrrolidin-1-ylethyl)benzenecarbothioamide;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc(Cl)ccc1C(=S)NCCN1CCCC1 |
| InChI | InChI=1S/C13H16ClN3O2S.ClH/c14-10-3-4-11(12(9-10)17(18)19)13(20)15-5-8-16-6-1-2-7-16;/h3-4,9H,1-2,5-8H2,(H,15,20);1H |
| InChIKey | SXSPHFVNKWFCPR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|