About 2-benzamidooxyacetic acid
2-benzamidooxyacetic acid (PubChem CID 21322) has the molecular formula C9H9NO4
and a molecular weight of 195.17 g/mol. Its IUPAC name is 2-benzamidooxyacetic acid.
Molecular Properties
| Compound Name | 2-benzamidooxyacetic acid |
| PubChem CID | 21322 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2-benzamidooxyacetic acid |
| SMILES | O=C(O)CONC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H9NO4/c11-8(12)6-14-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12) |
| InChIKey | WDRGQGLIUAMOOC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-benzamidooxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamidooxyacetic acid?
The IUPAC name of 2-benzamidooxyacetic acid (CID 21322) is 2-benzamidooxyacetic acid.
What is the SMILES notation for 2-benzamidooxyacetic acid?
The canonical SMILES for 2-benzamidooxyacetic acid is O=C(O)CONC(=O)c1ccccc1.
What is the InChIKey of 2-benzamidooxyacetic acid?
The InChIKey is WDRGQGLIUAMOOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4/c11-8(12)6-14-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12).
What are the key properties of 2-benzamidooxyacetic acid?
2-benzamidooxyacetic acid has a molecular weight of 195.17 g/mol, XLogP of 0.43, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamidooxyacetic acid is sourced from PubChem (CID 21322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).