About trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane
trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane (PubChem CID 21322045) has the molecular formula C12H24OSi
and a molecular weight of 212.41 g/mol. Its IUPAC name is trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane |
| PubChem CID | 21322045 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane |
| SMILES | C=CCC(C)(C/C=C/C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H24OSi/c1-7-9-11-12(3,10-8-2)13-14(4,5)6/h7-9H,2,10-11H2,1,3-6H3/b9-7+ |
| InChIKey | LAHYKKFTQUMPHW-VQHVLOKHSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane?
The IUPAC name of trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane (CID 21322045) is trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane.
What is the SMILES notation for trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane?
The canonical SMILES for trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane is C=CCC(C)(C/C=C/C)O[Si](C)(C)C.
What is the InChIKey of trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane?
The InChIKey is LAHYKKFTQUMPHW-VQHVLOKHSA-N. The full InChI is InChI=1S/C12H24OSi/c1-7-9-11-12(3,10-8-2)13-14(4,5)6/h7-9H,2,10-11H2,1,3-6H3/b9-7+.
What are the key properties of trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane?
trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane has a molecular weight of 212.41 g/mol, XLogP of 4.14, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(6E)-4-methylocta-1,6-dien-4-yl]oxysilane is sourced from PubChem (CID 21322045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).