About trimethyl(4-methylocta-1,7-dien-4-yloxy)silane
trimethyl(4-methylocta-1,7-dien-4-yloxy)silane (PubChem CID 21322046) has the molecular formula C12H24OSi
and a molecular weight of 212.41 g/mol. Its IUPAC name is trimethyl(4-methylocta-1,7-dien-4-yloxy)silane.
Molecular Properties
| Compound Name | trimethyl(4-methylocta-1,7-dien-4-yloxy)silane |
| PubChem CID | 21322046 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | trimethyl(4-methylocta-1,7-dien-4-yloxy)silane |
| SMILES | C=CCCC(C)(CC=C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H24OSi/c1-7-9-11-12(3,10-8-2)13-14(4,5)6/h7-8H,1-2,9-11H2,3-6H3 |
| InChIKey | IGLNHHBNSIAEBZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(4-methylocta-1,7-dien-4-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(4-methylocta-1,7-dien-4-yloxy)silane?
The IUPAC name of trimethyl(4-methylocta-1,7-dien-4-yloxy)silane (CID 21322046) is trimethyl(4-methylocta-1,7-dien-4-yloxy)silane.
What is the SMILES notation for trimethyl(4-methylocta-1,7-dien-4-yloxy)silane?
The canonical SMILES for trimethyl(4-methylocta-1,7-dien-4-yloxy)silane is C=CCCC(C)(CC=C)O[Si](C)(C)C.
What is the InChIKey of trimethyl(4-methylocta-1,7-dien-4-yloxy)silane?
The InChIKey is IGLNHHBNSIAEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24OSi/c1-7-9-11-12(3,10-8-2)13-14(4,5)6/h7-8H,1-2,9-11H2,3-6H3.
What are the key properties of trimethyl(4-methylocta-1,7-dien-4-yloxy)silane?
trimethyl(4-methylocta-1,7-dien-4-yloxy)silane has a molecular weight of 212.41 g/mol, XLogP of 4.14, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(4-methylocta-1,7-dien-4-yloxy)silane is sourced from PubChem (CID 21322046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).