About 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol
3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol (PubChem CID 21322597) has the molecular formula C16H16Br2O2
and a molecular weight of 400.11 g/mol. Its IUPAC name is 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol.
Molecular Properties
| Compound Name | 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol |
| PubChem CID | 21322597 |
| Molecular Formula | C16H16Br2O2 |
| Molecular Weight | 400.11 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol |
| SMILES | CC(O)(CCO)c1ccc(-c2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C16H16Br2O2/c1-16(20,8-9-19)12-4-2-11(3-5-12)14-7-6-13(17)10-15(14)18/h2-7,10,19-20H,8-9H2,1H3 |
| InChIKey | OMXYQEBZQZQKGP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.11 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol?
The IUPAC name of 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol (CID 21322597) is 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol.
What is the SMILES notation for 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol?
The canonical SMILES for 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol is CC(O)(CCO)c1ccc(-c2ccc(Br)cc2Br)cc1.
What is the InChIKey of 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol?
The InChIKey is OMXYQEBZQZQKGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Br2O2/c1-16(20,8-9-19)12-4-2-11(3-5-12)14-7-6-13(17)10-15(14)18/h2-7,10,19-20H,8-9H2,1H3.
What are the key properties of 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol?
3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol has a molecular weight of 400.11 g/mol, XLogP of 4.47, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,4-dibromophenyl)phenyl]butane-1,3-diol is sourced from PubChem (CID 21322597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).