C20H12Cl4N2O2 — CID 21322921
4,5,6,7-tetrachloro-2-(2,4,8-trimethylquinolin-6-yl)isoindole-1,3-dione (PubChem CID 21322921) has the molecular formula C20H12Cl4N2O2 and a molecular weight of 454.14 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-(2,4,8-trimethylquinolin-6-yl)isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-(2,4,8-trimethylquinolin-6-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 21322921 |
| Molecular Formula | C20H12Cl4N2O2 |
| Molecular Weight | 454.14 g/mol |
| Exact Mass | 451.97 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-(2,4,8-trimethylquinolin-6-yl)isoindole-1,3-dione |
| SMILES | Cc1cc(C)c2cc(N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)cc(C)c2n1 |
| InChI | InChI=1S/C20H12Cl4N2O2/c1-7-4-9(3)25-18-8(2)5-10(6-11(7)18)26-19(27)12-13(20(26)28)15(22)17(24)16(23)14(12)21/h4-6H,1-3H3 |
| InChIKey | GOCWFHZJQCFARK-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.14 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|