C15H9ClN2O3 — CID 21323801
6-(4-chlorophenyl)-3-phenyl-1,3,5-oxadiazine-2,4-dione (PubChem CID 21323801) has the molecular formula C15H9ClN2O3 and a molecular weight of 300.70 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-phenyl-1,3,5-oxadiazine-2,4-dione.
| Compound Name | 6-(4-chlorophenyl)-3-phenyl-1,3,5-oxadiazine-2,4-dione |
|---|---|
| PubChem CID | 21323801 |
| Molecular Formula | C15H9ClN2O3 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 6-(4-chlorophenyl)-3-phenyl-1,3,5-oxadiazine-2,4-dione |
| SMILES | O=c1nc(-c2ccc(Cl)cc2)oc(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C15H9ClN2O3/c16-11-8-6-10(7-9-11)13-17-14(19)18(15(20)21-13)12-4-2-1-3-5-12/h1-9H |
| InChIKey | HEMKUDVXVRXWFW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |