C15H8Cl2N2O3 — CID 21323812
3,6-bis(4-chlorophenyl)-1,3,5-oxadiazine-2,4-dione (PubChem CID 21323812) has the molecular formula C15H8Cl2N2O3 and a molecular weight of 335.15 g/mol. Its IUPAC name is 3,6-bis(4-chlorophenyl)-1,3,5-oxadiazine-2,4-dione.
| Compound Name | 3,6-bis(4-chlorophenyl)-1,3,5-oxadiazine-2,4-dione |
|---|---|
| PubChem CID | 21323812 |
| Molecular Formula | C15H8Cl2N2O3 |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 3,6-bis(4-chlorophenyl)-1,3,5-oxadiazine-2,4-dione |
| SMILES | O=c1nc(-c2ccc(Cl)cc2)oc(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H8Cl2N2O3/c16-10-3-1-9(2-4-10)13-18-14(20)19(15(21)22-13)12-7-5-11(17)6-8-12/h1-8H |
| InChIKey | OPLHLSSAKBBRGH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |