About ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate
ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 2132388) has the molecular formula C24H19FN2O5S
and a molecular weight of 466.49 g/mol. Its IUPAC name is ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| PubChem CID | 2132388 |
| Molecular Formula | C24H19FN2O5S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H19FN2O5S/c1-2-32-24(31)20-18(14-7-9-15(25)10-8-14)13-33-21(20)26-19(28)11-12-27-22(29)16-5-3-4-6-17(16)23(27)30/h3-10,13H,2,11-12H2,1H3,(H,26,28) |
| InChIKey | LEJROLSLSCHSRL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate?
The IUPAC name of ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate (CID 2132388) is ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
What is the SMILES notation for ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate?
The canonical SMILES for ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate is CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)CCN1C(=O)c2ccccc2C1=O.
What is the InChIKey of ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate?
The InChIKey is LEJROLSLSCHSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19FN2O5S/c1-2-32-24(31)20-18(14-7-9-15(25)10-8-14)13-33-21(20)26-19(28)11-12-27-22(29)16-5-3-4-6-17(16)23(27)30/h3-10,13H,2,11-12H2,1H3,(H,26,28).
What are the key properties of ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate?
ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate has a molecular weight of 466.49 g/mol, XLogP of 4.36, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate is sourced from PubChem (CID 2132388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).