C14H22N4OS — CID 21324090
5-but-3-enyl-1-(3-ethyl-4-methyl-1,2-thiazol-5-yl)-3-methyl-1,3,5-triazinan-2-one (PubChem CID 21324090) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 5-but-3-enyl-1-(3-ethyl-4-methyl-1,2-thiazol-5-yl)-3-methyl-1,3,5-triazinan-2-one.
| Compound Name | 5-but-3-enyl-1-(3-ethyl-4-methyl-1,2-thiazol-5-yl)-3-methyl-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 21324090 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 5-but-3-enyl-1-(3-ethyl-4-methyl-1,2-thiazol-5-yl)-3-methyl-1,3,5-triazinan-2-one |
| SMILES | C=CCCN1CN(C)C(=O)N(c2snc(CC)c2C)C1 |
| InChI | InChI=1S/C14H22N4OS/c1-5-7-8-17-9-16(4)14(19)18(10-17)13-11(3)12(6-2)15-20-13/h5H,1,6-10H2,2-4H3 |
| InChIKey | VIRUBPVDCILMHB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|