C17H20ClN5O3S — CID 21324229
3-[(4-chlorophenyl)-ethylsulfamoyl]-N,N-bis(prop-2-enyl)-1,2,4-triazole-1-carboxamide (PubChem CID 21324229) has the molecular formula C17H20ClN5O3S and a molecular weight of 409.90 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)-ethylsulfamoyl]-N,N-bis(prop-2-enyl)-1,2,4-triazole-1-carboxamide.
| Compound Name | 3-[(4-chlorophenyl)-ethylsulfamoyl]-N,N-bis(prop-2-enyl)-1,2,4-triazole-1-carboxamide |
|---|---|
| PubChem CID | 21324229 |
| Molecular Formula | C17H20ClN5O3S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 3-[(4-chlorophenyl)-ethylsulfamoyl]-N,N-bis(prop-2-enyl)-1,2,4-triazole-1-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)n1cnc(S(=O)(=O)N(CC)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H20ClN5O3S/c1-4-11-21(12-5-2)17(24)22-13-19-16(20-22)27(25,26)23(6-3)15-9-7-14(18)8-10-15/h4-5,7-10,13H,1-2,6,11-12H2,3H3 |
| InChIKey | HWTQFQZNHVNRIU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|