C12H19N5O3S — CID 21324316
3-[ethyl(methyl)sulfamoyl]-N,N-bis(prop-2-enyl)-1,2,4-triazole-1-carboxamide (PubChem CID 21324316) has the molecular formula C12H19N5O3S and a molecular weight of 313.38 g/mol. Its IUPAC name is 3-[ethyl(methyl)sulfamoyl]-N,N-bis(prop-2-enyl)-1,2,4-triazole-1-carboxamide.
| Compound Name | 3-[ethyl(methyl)sulfamoyl]-N,N-bis(prop-2-enyl)-1,2,4-triazole-1-carboxamide |
|---|---|
| PubChem CID | 21324316 |
| Molecular Formula | C12H19N5O3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 3-[ethyl(methyl)sulfamoyl]-N,N-bis(prop-2-enyl)-1,2,4-triazole-1-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)n1cnc(S(=O)(=O)N(C)CC)n1 |
| InChI | InChI=1S/C12H19N5O3S/c1-5-8-16(9-6-2)12(18)17-10-13-11(14-17)21(19,20)15(4)7-3/h5-6,10H,1-2,7-9H2,3-4H3 |
| InChIKey | HJPBGLVPUCSVGA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|