About N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide
N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide (PubChem CID 21324359) has the molecular formula C5H10N4O2S
and a molecular weight of 190.23 g/mol. Its IUPAC name is N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide |
| PubChem CID | 21324359 |
| Molecular Formula | C5H10N4O2S |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide |
| SMILES | CCN(C)S(=O)(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C5H10N4O2S/c1-3-9(2)12(10,11)5-6-4-7-8-5/h4H,3H2,1-2H3,(H,6,7,8) |
| InChIKey | VSKYXLUJRPFGHQ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide?
The IUPAC name of N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide (CID 21324359) is N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide.
What is the SMILES notation for N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide?
The canonical SMILES for N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide is CCN(C)S(=O)(=O)c1ncn[nH]1.
What is the InChIKey of N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide?
The InChIKey is VSKYXLUJRPFGHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4O2S/c1-3-9(2)12(10,11)5-6-4-7-8-5/h4H,3H2,1-2H3,(H,6,7,8).
What are the key properties of N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide?
N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide has a molecular weight of 190.23 g/mol, XLogP of -0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-1H-1,2,4-triazole-5-sulfonamide is sourced from PubChem (CID 21324359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).