About N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide
N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide (PubChem CID 21324403) has the molecular formula C8H16N4O2S
and a molecular weight of 232.31 g/mol. Its IUPAC name is N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide |
| PubChem CID | 21324403 |
| Molecular Formula | C8H16N4O2S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide |
| SMILES | CCCCN(CC)S(=O)(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C8H16N4O2S/c1-3-5-6-12(4-2)15(13,14)8-9-7-10-11-8/h7H,3-6H2,1-2H3,(H,9,10,11) |
| InChIKey | GUSHQPFKBUZGPP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide?
The IUPAC name of N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide (CID 21324403) is N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide.
What is the SMILES notation for N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide?
The canonical SMILES for N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide is CCCCN(CC)S(=O)(=O)c1ncn[nH]1.
What is the InChIKey of N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide?
The InChIKey is GUSHQPFKBUZGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O2S/c1-3-5-6-12(4-2)15(13,14)8-9-7-10-11-8/h7H,3-6H2,1-2H3,(H,9,10,11).
What are the key properties of N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide?
N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide has a molecular weight of 232.31 g/mol, XLogP of 0.62, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-ethyl-1H-1,2,4-triazole-5-sulfonamide is sourced from PubChem (CID 21324403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).