About N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide
N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide (PubChem CID 21324407) has the molecular formula C7H14N4O2S
and a molecular weight of 218.28 g/mol. Its IUPAC name is N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide |
| PubChem CID | 21324407 |
| Molecular Formula | C7H14N4O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide |
| SMILES | CCC(C)N(C)S(=O)(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C7H14N4O2S/c1-4-6(2)11(3)14(12,13)7-8-5-9-10-7/h5-6H,4H2,1-3H3,(H,8,9,10) |
| InChIKey | VRORRWBNKOKMBS-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide?
The IUPAC name of N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide (CID 21324407) is N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide.
What is the SMILES notation for N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide?
The canonical SMILES for N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide is CCC(C)N(C)S(=O)(=O)c1ncn[nH]1.
What is the InChIKey of N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide?
The InChIKey is VRORRWBNKOKMBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O2S/c1-4-6(2)11(3)14(12,13)7-8-5-9-10-7/h5-6H,4H2,1-3H3,(H,8,9,10).
What are the key properties of N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide?
N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide has a molecular weight of 218.28 g/mol, XLogP of 0.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-N-methyl-1H-1,2,4-triazole-5-sulfonamide is sourced from PubChem (CID 21324407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).