About 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione
5-ethenyl-3-methyl-1,3-thiazolidine-2-thione (PubChem CID 21324783) has the molecular formula C6H9NS2
and a molecular weight of 159.28 g/mol. Its IUPAC name is 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione.
Molecular Properties
| Compound Name | 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione |
| PubChem CID | 21324783 |
| Molecular Formula | C6H9NS2 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione |
| SMILES | C=CC1CN(C)C(=S)S1 |
| InChI | InChI=1S/C6H9NS2/c1-3-5-4-7(2)6(8)9-5/h3,5H,1,4H2,2H3 |
| InChIKey | IBYQNSLQEHRQQB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione?
The IUPAC name of 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione (CID 21324783) is 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione.
What is the SMILES notation for 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione?
The canonical SMILES for 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione is C=CC1CN(C)C(=S)S1.
What is the InChIKey of 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione?
The InChIKey is IBYQNSLQEHRQQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NS2/c1-3-5-4-7(2)6(8)9-5/h3,5H,1,4H2,2H3.
What are the key properties of 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione?
5-ethenyl-3-methyl-1,3-thiazolidine-2-thione has a molecular weight of 159.28 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-3-methyl-1,3-thiazolidine-2-thione is sourced from PubChem (CID 21324783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).