C25H14ClN3OS2 — CID 2132485
13-(4-chlorophenyl)-8-phenylsulfanyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one (PubChem CID 2132485) has the molecular formula C25H14ClN3OS2 and a molecular weight of 471.99 g/mol. Its IUPAC name is 13-(4-chlorophenyl)-8-phenylsulfanyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one.
| Compound Name | 13-(4-chlorophenyl)-8-phenylsulfanyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one |
|---|---|
| PubChem CID | 2132485 |
| Molecular Formula | C25H14ClN3OS2 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 13-(4-chlorophenyl)-8-phenylsulfanyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one |
| SMILES | O=c1c2c(-c3ccc(Cl)cc3)csc2nc2c3ccccc3c(Sc3ccccc3)nn12 |
| InChI | InChI=1S/C25H14ClN3OS2/c26-16-12-10-15(11-13-16)20-14-31-24-21(20)25(30)29-22(27-24)18-8-4-5-9-19(18)23(28-29)32-17-6-2-1-3-7-17/h1-14H |
| InChIKey | OOUXHMXNVLVREJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|