About 1-piperazin-2-ylazocane
1-piperazin-2-ylazocane (PubChem CID 21324979) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 1-piperazin-2-ylazocane.
Molecular Properties
| Compound Name | 1-piperazin-2-ylazocane |
| PubChem CID | 21324979 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 1-piperazin-2-ylazocane |
| SMILES | C1CCCN(C2CNCCN2)CCC1 |
| InChI | InChI=1S/C11H23N3/c1-2-4-8-14(9-5-3-1)11-10-12-6-7-13-11/h11-13H,1-10H2 |
| InChIKey | IDKVOUBIEXHKRC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-piperazin-2-ylazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperazin-2-ylazocane?
The IUPAC name of 1-piperazin-2-ylazocane (CID 21324979) is 1-piperazin-2-ylazocane.
What is the SMILES notation for 1-piperazin-2-ylazocane?
The canonical SMILES for 1-piperazin-2-ylazocane is C1CCCN(C2CNCCN2)CCC1.
What is the InChIKey of 1-piperazin-2-ylazocane?
The InChIKey is IDKVOUBIEXHKRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3/c1-2-4-8-14(9-5-3-1)11-10-12-6-7-13-11/h11-13H,1-10H2.
What are the key properties of 1-piperazin-2-ylazocane?
1-piperazin-2-ylazocane has a molecular weight of 197.33 g/mol, XLogP of 0.77, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperazin-2-ylazocane is sourced from PubChem (CID 21324979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).