C21H37IO2 — CID 21325427
1-[(E)-5-(1-ethoxyethoxy)-7-iodohept-6-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 21325427) has the molecular formula C21H37IO2 and a molecular weight of 448.43 g/mol. Its IUPAC name is 1-[(E)-5-(1-ethoxyethoxy)-7-iodohept-6-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 1-[(E)-5-(1-ethoxyethoxy)-7-iodohept-6-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 21325427 |
| Molecular Formula | C21H37IO2 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 1-[(E)-5-(1-ethoxyethoxy)-7-iodohept-6-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCOC(C)OC(/C=C/I)CCCCC1CCCC2CCCCC12 |
| InChI | InChI=1S/C21H37IO2/c1-3-23-17(2)24-20(15-16-22)13-6-4-9-18-11-8-12-19-10-5-7-14-21(18)19/h15-21H,3-14H2,1-2H3/b16-15+ |
| InChIKey | ZMJLVQRUUGCRRS-FOCLMDBBSA-N |
| XLogP | 6.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|