C23H19N3O4 — CID 21325609
4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-2,6-diphenylphenol (PubChem CID 21325609) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-2,6-diphenylphenol.
| Compound Name | 4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-2,6-diphenylphenol |
|---|---|
| PubChem CID | 21325609 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]-2,6-diphenylphenol |
| SMILES | COc1nc(OC)nc(Oc2cc(-c3ccccc3)c(O)c(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C23H19N3O4/c1-28-21-24-22(29-2)26-23(25-21)30-17-13-18(15-9-5-3-6-10-15)20(27)19(14-17)16-11-7-4-8-12-16/h3-14,27H,1-2H3 |
| InChIKey | PIQQDJBXDYRKAJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |