About 2-tert-butyl-3,5,6-trimethylphenol
2-tert-butyl-3,5,6-trimethylphenol (PubChem CID 21325620) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 2-tert-butyl-3,5,6-trimethylphenol.
Molecular Properties
| Compound Name | 2-tert-butyl-3,5,6-trimethylphenol |
| PubChem CID | 21325620 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 2-tert-butyl-3,5,6-trimethylphenol |
| SMILES | Cc1cc(C)c(C(C)(C)C)c(O)c1C |
| InChI | InChI=1S/C13H20O/c1-8-7-9(2)11(13(4,5)6)12(14)10(8)3/h7,14H,1-6H3 |
| InChIKey | ULUYMRWMVTYGQK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-3,5,6-trimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3,5,6-trimethylphenol?
The IUPAC name of 2-tert-butyl-3,5,6-trimethylphenol (CID 21325620) is 2-tert-butyl-3,5,6-trimethylphenol.
What is the SMILES notation for 2-tert-butyl-3,5,6-trimethylphenol?
The canonical SMILES for 2-tert-butyl-3,5,6-trimethylphenol is Cc1cc(C)c(C(C)(C)C)c(O)c1C.
What is the InChIKey of 2-tert-butyl-3,5,6-trimethylphenol?
The InChIKey is ULUYMRWMVTYGQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-8-7-9(2)11(13(4,5)6)12(14)10(8)3/h7,14H,1-6H3.
What are the key properties of 2-tert-butyl-3,5,6-trimethylphenol?
2-tert-butyl-3,5,6-trimethylphenol has a molecular weight of 192.30 g/mol, XLogP of 3.61, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3,5,6-trimethylphenol is sourced from PubChem (CID 21325620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).